Products 2902-98-9

CAS 2902-98-9 appears in our catalog under these names: 2-CHLORO-2,2-DIPHENYLACETYL CHLORIDE, 9&, 2-Chloro-2,2-diphenylacetyl chloride, 95%, 2-Chloro-2,2-diphenylacetylchloride, 97%. Offered by: Sigma-Aldrich, Combi-blocks, AmBeed. Available pack sizes: 25G, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-chloro-2,2-diphenylacetyl chloride (CAS 2902-98-9) is a chemical compound with the molecular formula C14H10Cl2O and a molecular weight of 265.1 g/mol. IUPAC name: 2-chloro-2,2-diphenylacetyl chloride. InChIKey: NFHKZAUDRWRXMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10Cl2O
Molecular weight265.1 g/mol
IUPAC name2-chloro-2,2-diphenylacetyl chloride
InChIKeyNFHKZAUDRWRXMZ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)(C(=O)Cl)Cl

Computed by PubChem (NCBI)