CAS 926254-63-9 appears in our catalog under these names: 1-(4-(3,4-Dichlorophenyl)phenyl)ethan-1-one, 95%, 1-(4-(3,4-Dichlorophenyl)phenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-[4-(3,4-dichlorophenyl)phenyl]ethanone (CAS 926254-63-9) is a chemical compound with the molecular formula C14H10Cl2O and a molecular weight of 265.1 g/mol. IUPAC name: 1-[4-(3,4-dichlorophenyl)phenyl]ethanone. InChIKey: RNKOSEHGDMAEHV-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O |
|---|---|
| Molecular weight | 265.1 g/mol |
| IUPAC name | 1-[4-(3,4-dichlorophenyl)phenyl]ethanone |
| InChIKey | RNKOSEHGDMAEHV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)