Products 2902654-63-9
CAS 2902654-63-9 is the registry number for 3-(3-Fluoro-4-(hydroxymethyl)phenyl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-fluoro-4-(hydroxymethyl)phenyl]piperidine-2,6-dione (CAS 2902654-63-9) is a chemical compound with the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. IUPAC name: 3-[3-fluoro-4-(hydroxymethyl)phenyl]piperidine-2,6-dione. InChIKey: JCEDGPUXKKTKDU-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO3 |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 3-[3-fluoro-4-(hydroxymethyl)phenyl]piperidine-2,6-dione |
| InChIKey | JCEDGPUXKKTKDU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC(=C(C=C2)CO)F |
Computed by PubChem (NCBI)