Products 2903379-58-6
CAS 2903379-58-6 appears in our catalog under these names: exo-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octane hydrochloride, 95%, exo-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octane,hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
(1R,5S)-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octane;hydrochloride (CAS 2903379-58-6) is a chemical compound with the molecular formula C8H13ClF3N and a molecular weight of 215.64 g/mol. IUPAC name: (1R,5S)-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octane;hydrochloride. InChIKey: FPHCEZGZEPZRAP-FXFNDYDPSA-N.
| Molecular formula | C8H13ClF3N |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | (1R,5S)-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | FPHCEZGZEPZRAP-FXFNDYDPSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)