Products 3090840-32-4
CAS 3090840-32-4 is the registry number for 6-(Trifluoromethyl)spiro[3.3]heptan-2-amine Hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-(trifluoromethyl)spiro[3.3]heptan-2-amine;hydrochloride (CAS 3090840-32-4) is a chemical compound with the molecular formula C8H13ClF3N and a molecular weight of 215.64 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[3.3]heptan-2-amine;hydrochloride. InChIKey: UTEJGWQEGRTRPO-UHFFFAOYSA-N.
| Molecular formula | C8H13ClF3N |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[3.3]heptan-2-amine;hydrochloride |
| InChIKey | UTEJGWQEGRTRPO-UHFFFAOYSA-N |
| SMILES | C1C(CC12CC(C2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)