CAS 2903433-17-8 is the registry number for rel-(3R,5S)-3,5-Dimethylpiperidin-4-yl 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,5S)-3,5-dimethylpiperidin-4-yl] 2,2,2-trifluoroacetate (CAS 2903433-17-8) is a chemical compound with the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. IUPAC name: [(3R,5S)-3,5-dimethylpiperidin-4-yl] 2,2,2-trifluoroacetate. InChIKey: QPVDBMZLARIJPK-MEKDEQNOSA-N.
| Molecular formula | C9H14F3NO2 |
|---|---|
| Molecular weight | 225.21 g/mol |
| IUPAC name | [(3R,5S)-3,5-dimethylpiperidin-4-yl] 2,2,2-trifluoroacetate |
| InChIKey | QPVDBMZLARIJPK-MEKDEQNOSA-N |
| SMILES | C[C@@H]1CNC[C@@H](C1OC(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)