Products 480438-80-0

CAS 480438-80-0 is the registry number for 3,3,3-Trifluoro-(2-piperidinylmethyl)propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3,3,3-trifluoro-2-(piperidin-2-ylmethyl)propanoic acid (CAS 480438-80-0) is a chemical compound with the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. IUPAC name: 3,3,3-trifluoro-2-(piperidin-2-ylmethyl)propanoic acid. InChIKey: PQIQQLVQNDTREE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14F3NO2
Molecular weight225.21 g/mol
IUPAC name3,3,3-trifluoro-2-(piperidin-2-ylmethyl)propanoic acid
InChIKeyPQIQQLVQNDTREE-UHFFFAOYSA-N
SMILESC1CCNC(C1)CC(C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)