CAS 2904-41-8 appears in our catalog under these names: Tris(2–carboxyethyl) isocyanurate, Tris(2-carboxyethyl) Isocyanurate, >98.0%(HPLC)(T), 3,3',3''-(2,4,6-Trioxo-1,3,5-triazinane-1,3,5-triyl)tripropionic acid 98%, Tris(2-carboxyethyl) Isocyanurate, 98%, 98%, Tris(2-carboxyethyl) isocyanurate, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 25g, 5g, 100g.
3-[3,5-bis(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid (CAS 2904-41-8) is a chemical compound with the molecular formula C12H15N3O9 and a molecular weight of 345.26 g/mol. IUPAC name: 3-[3,5-bis(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid. InChIKey: HENCHDCLZDQGIQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O9 |
|---|---|
| Molecular weight | 345.26 g/mol |
| IUPAC name | 3-[3,5-bis(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid |
| InChIKey | HENCHDCLZDQGIQ-UHFFFAOYSA-N |
| SMILES | C(CN1C(=O)N(C(=O)N(C1=O)CCC(=O)O)CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)