CAS 7253-54-5 is the registry number for NSC 66058. Offered by: TRC. Available pack sizes: 2,5g.
3-(2,4-dinitroanilino)-6-(hydroxymethyl)oxane-2,4,5-triol (CAS 7253-54-5) is a chemical compound with the molecular formula C12H15N3O9 and a molecular weight of 345.26 g/mol. IUPAC name: 3-(2,4-dinitroanilino)-6-(hydroxymethyl)oxane-2,4,5-triol. InChIKey: YMQMVONSQIWFNM-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O9 |
|---|---|
| Molecular weight | 345.26 g/mol |
| IUPAC name | 3-(2,4-dinitroanilino)-6-(hydroxymethyl)oxane-2,4,5-triol |
| InChIKey | YMQMVONSQIWFNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NC2C(C(C(OC2O)CO)O)O |
Computed by PubChem (NCBI)