CAS 2904-57-6 appears in our catalog under these names: Mesitonitrile N-Oxide, 2,4,6-Trimethylbenzonitrile N-oxide. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 1000mg, 5000mg.
2,4,6-trimethylbenzonitrile oxide (CAS 2904-57-6) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: 2,4,6-trimethylbenzonitrile oxide. InChIKey: ZILPALOUYKHPKI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 2,4,6-trimethylbenzonitrile oxide |
| InChIKey | ZILPALOUYKHPKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C#[N+][O-])C |
Computed by PubChem (NCBI)