CAS 2907-13-3 is the registry number for 2-(4-Methoxyphenyl)-4,6-Diphenylpyrylium Tetrafluoroborate. Offered by: TRC. Available pack sizes: 500mg.
2-(4-methoxyphenyl)-4,6-diphenylpyrylium tetrafluoroborate (CAS 2907-13-3) is a chemical compound with the molecular formula C24H19BF4O2 and a molecular weight of 426.2 g/mol. IUPAC name: 2-(4-methoxyphenyl)-4,6-diphenylpyrylium tetrafluoroborate. InChIKey: UIIOBZUIYIEPJW-UHFFFAOYSA-N.
| Molecular formula | C24H19BF4O2 |
|---|---|
| Molecular weight | 426.2 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-4,6-diphenylpyrylium tetrafluoroborate |
| InChIKey | UIIOBZUIYIEPJW-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.COC1=CC=C(C=C1)C2=CC(=CC(=[O+]2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)