CAS 2907-20-2 is the registry number for 2,5-Diphenyl-3-(4-methoxyphenyl)pyronium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg.
4-(4-methoxyphenyl)-2,6-diphenylpyrylium tetrafluoroborate (CAS 2907-20-2) is a chemical compound with the molecular formula C24H19BF4O2 and a molecular weight of 426.2 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2,6-diphenylpyrylium tetrafluoroborate. InChIKey: IFPWQTORUCNMQM-UHFFFAOYSA-N.
| Molecular formula | C24H19BF4O2 |
|---|---|
| Molecular weight | 426.2 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-2,6-diphenylpyrylium tetrafluoroborate |
| InChIKey | IFPWQTORUCNMQM-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.COC1=CC=C(C=C1)C2=CC(=[O+]C(=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)