Products 2907-20-2

CAS 2907-20-2 is the registry number for 2,5-Diphenyl-3-(4-methoxyphenyl)pyronium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

4-(4-methoxyphenyl)-2,6-diphenylpyrylium tetrafluoroborate (CAS 2907-20-2) is a chemical compound with the molecular formula C24H19BF4O2 and a molecular weight of 426.2 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2,6-diphenylpyrylium tetrafluoroborate. InChIKey: IFPWQTORUCNMQM-UHFFFAOYSA-N.

Identity
Molecular formulaC24H19BF4O2
Molecular weight426.2 g/mol
IUPAC name4-(4-methoxyphenyl)-2,6-diphenylpyrylium tetrafluoroborate
InChIKeyIFPWQTORUCNMQM-UHFFFAOYSA-N
SMILES[B-](F)(F)(F)F.COC1=CC=C(C=C1)C2=CC(=[O+]C(=C2)C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)