CAS 50868-68-3 appears in our catalog under these names: (E)–3–(5–Bromothiophen–2–yl)acrylic acid, (E)-3-(5-Bromothiophen-2-yl)acrylic acid, (E)-3-(5-Bromothiophen-2-yl)acrylic acid, 98%, 98%, (E)-3-(5-Bromothiophen-2-yl)acrylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg, 100mg, 500mg, 25g.
(E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid (CAS 50868-68-3) is a chemical compound with the molecular formula C7H5BrO2S and a molecular weight of 233.08 g/mol. IUPAC name: (E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid. InChIKey: UNAWXLDSXIIUFC-DUXPYHPUSA-N.
| Molecular formula | C7H5BrO2S |
|---|---|
| Molecular weight | 233.08 g/mol |
| IUPAC name | (E)-3-(5-bromothiophen-2-yl)prop-2-enoic acid |
| InChIKey | UNAWXLDSXIIUFC-DUXPYHPUSA-N |
| SMILES | C1=C(SC(=C1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)