Products 29102-97-4
CAS 29102-97-4 is the registry number for 7-Bromo-4-chlorobenzo[d]isothiazole, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
7-bromo-4-chloro-1,2-benzothiazole (CAS 29102-97-4) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 7-bromo-4-chloro-1,2-benzothiazole. InChIKey: NMRQEHYSMQRTBW-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 7-bromo-4-chloro-1,2-benzothiazole |
| InChIKey | NMRQEHYSMQRTBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C=NS2)Br |
Computed by PubChem (NCBI)