CAS 291279-94-2 appears in our catalog under these names: 4-(4-(2-Methylbutan-2-yl)phenoxy)aniline hydrochloride, 95%, 4-[4-(1,1-Dimethylpropyl)phenoxy]aniline hydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-[4-(2-methylbutan-2-yl)phenoxy]aniline;hydrochloride (CAS 291279-94-2) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 291.8 g/mol. IUPAC name: 4-[4-(2-methylbutan-2-yl)phenoxy]aniline;hydrochloride. InChIKey: CRCKPOYIMQUXEB-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 291.8 g/mol |
| IUPAC name | 4-[4-(2-methylbutan-2-yl)phenoxy]aniline;hydrochloride |
| InChIKey | CRCKPOYIMQUXEB-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)OC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)