CAS 1219795-16-0 appears in our catalog under these names: Diphenhydramine-d5 HCl, Diphenhydramine-d5 HCl (phenyl-d5), 99 atom % D, min 98% Chemical Purity, Diphenhydramine-d5 HCl (phenyl-d5), >95% (HPLC), Diphenhydramine-d5 Hydrochloride (Phenyl-d5), >95% (HPLC), Diphenhydramine–d5 hydrochloride. Offered by: Chemat Brand, CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 0,1g, 0,05g, 10mg, 1mg, 2mg, 5mg, 5 mg.
N,N-dimethyl-2-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethoxy]ethanamine;hydrochloride (CAS 1219795-16-0) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 296.8 g/mol. IUPAC name: N,N-dimethyl-2-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethoxy]ethanamine;hydrochloride. InChIKey: PCHPORCSPXIHLZ-BSBWQDPUSA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 296.8 g/mol |
| IUPAC name | N,N-dimethyl-2-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethoxy]ethanamine;hydrochloride |
| InChIKey | PCHPORCSPXIHLZ-BSBWQDPUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=CC=CC=C2)OCCN(C)C)[2H])[2H].Cl |
Computed by PubChem (NCBI)