Products 2914922-86-2
CAS 2914922-86-2 is the registry number for Anticancer agent 102. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(butylamino)benzamide (CAS 2914922-86-2) is a chemical compound with the molecular formula C20H19F6N3O and a molecular weight of 431.4 g/mol. IUPAC name: N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(butylamino)benzamide. InChIKey: HMVYHIGKKXHIGK-KVSWJAHQSA-N.
| Molecular formula | C20H19F6N3O |
|---|---|
| Molecular weight | 431.4 g/mol |
| IUPAC name | N-[(E)-[3,5-bis(trifluoromethyl)phenyl]methylideneamino]-4-(butylamino)benzamide |
| InChIKey | HMVYHIGKKXHIGK-KVSWJAHQSA-N |
| SMILES | CCCCNC1=CC=C(C=C1)C(=O)N/N=C/C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)