CAS 329778-87-2 is the registry number for N-(3,5-bis(trifluoromethyl)phenyl)-2-(4-phenylpiperazinyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-phenylpiperazin-1-yl)acetamide (CAS 329778-87-2) is a chemical compound with the molecular formula C20H19F6N3O and a molecular weight of 431.4 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-phenylpiperazin-1-yl)acetamide. InChIKey: LXJAZFZFNUSXLV-UHFFFAOYSA-N.
| Molecular formula | C20H19F6N3O |
|---|---|
| Molecular weight | 431.4 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-phenylpiperazin-1-yl)acetamide |
| InChIKey | LXJAZFZFNUSXLV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)