CAS 2915-49-3 appears in our catalog under these names: Bis(2-ethylhexyl) 4-cyclohexene-1,2-dicarboxylate, 97%, Bis(2-ethylhexyl) cyclohex-4-ene-1,2-dicarboxylate, 97%, Bis(2–ethylhexyl) cyclohex–4–ene–1,2–dicarboxylate, Bis(2-ethylhexyl) 4-Cyclohexene-1,2-dicarboxylate, >97.0%(GC), Bis(2-ethylhexyl) cyclohex-4-ene-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1kg, 100g, 500g, 25g.
Bis(2-ethylhexyl) cyclohex-4-ene-1,2-dicarboxylate (CAS 2915-49-3) is a chemical compound with the molecular formula C24H42O4 and a molecular weight of 394.6 g/mol. IUPAC name: bis(2-ethylhexyl) cyclohex-4-ene-1,2-dicarboxylate. InChIKey: SVVBLKNHJWTATO-UHFFFAOYSA-N.
| Molecular formula | C24H42O4 |
|---|---|
| Molecular weight | 394.6 g/mol |
| IUPAC name | bis(2-ethylhexyl) cyclohex-4-ene-1,2-dicarboxylate |
| InChIKey | SVVBLKNHJWTATO-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1CC=CCC1C(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)