CAS 34212-59-4 appears in our catalog under these names: (1R)-(-)-Dimenthyl succinate, 95%, Bis((1S,2R,5S)-2-isopropyl-5-methylcyclohexyl) succinate, 98%, Dimenthyl Succinate, bis((1R,2S,5R)–2–isopropyl–5–methylcyclohexyl) succinate, (1R)-(-)-Dimenthyl succinate 95%. Offered by: Combi-blocks, AmBeed, TRC, GLPBio, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 100mg, 250mg.
Bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate (CAS 34212-59-4) is a chemical compound with the molecular formula C24H42O4 and a molecular weight of 394.6 g/mol. IUPAC name: bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate. InChIKey: YZXZAUAIVAZWFN-KQFPAPQFSA-N.
| Molecular formula | C24H42O4 |
|---|---|
| Molecular weight | 394.6 g/mol |
| IUPAC name | bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] butanedioate |
| InChIKey | YZXZAUAIVAZWFN-KQFPAPQFSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCC(=O)O[C@@H]2C[C@@H](CC[C@H]2C(C)C)C)C(C)C |
Computed by PubChem (NCBI)