Products 2915651-00-0
CAS 2915651-00-0 is the registry number for PARP-2-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3-(diethylamino)propanamide (CAS 2915651-00-0) is a chemical compound with the molecular formula C20H22ClN3O2 and a molecular weight of 371.9 g/mol. IUPAC name: N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3-(diethylamino)propanamide. InChIKey: SWRCSUDDSSRBLV-UHFFFAOYSA-N.
| Molecular formula | C20H22ClN3O2 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | N-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-3-(diethylamino)propanamide |
| InChIKey | SWRCSUDDSSRBLV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC(=O)NC1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)