Products 356559-13-2
CAS 356559-13-2 appears in our catalog under these names: SB-505124 hydrochloride/ 98%, SB–505124 hydrochloride, TGF-╬▓ RI Kinase Inhibitor II 1PC X 2MG, SB-505124 hydrochloride, ≥97%, ≥97%, SB-505124 (hydrochloride), 98.52%. Offered by: TargetMol, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 2MG.
2-[4-(1,3-benzodioxol-5-yl)-2-tert-butyl-1H-imidazol-5-yl]-6-methylpyridine;hydrochloride (CAS 356559-13-2) is a chemical compound with the molecular formula C20H22ClN3O2 and a molecular weight of 371.9 g/mol. IUPAC name: 2-[4-(1,3-benzodioxol-5-yl)-2-tert-butyl-1H-imidazol-5-yl]-6-methylpyridine;hydrochloride. InChIKey: BTUOOXPZOVNPMF-UHFFFAOYSA-N.
| Molecular formula | C20H22ClN3O2 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | 2-[4-(1,3-benzodioxol-5-yl)-2-tert-butyl-1H-imidazol-5-yl]-6-methylpyridine;hydrochloride |
| InChIKey | BTUOOXPZOVNPMF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=C(N=C(N2)C(C)(C)C)C3=CC4=C(C=C3)OCO4.Cl |
Computed by PubChem (NCBI)