Products 29161-67-9
CAS 29161-67-9 is the registry number for Photolumazine I. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2,4,7-trioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-6-yl]propanoic acid (CAS 29161-67-9) is a chemical compound with the molecular formula C14H18N4O9 and a molecular weight of 386.31 g/mol. IUPAC name: 3-[2,4,7-trioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-6-yl]propanoic acid. InChIKey: PTYCEIBBGGLADD-PJKMHFRUSA-N.
| Molecular formula | C14H18N4O9 |
|---|---|
| Molecular weight | 386.31 g/mol |
| IUPAC name | 3-[2,4,7-trioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-6-yl]propanoic acid |
| InChIKey | PTYCEIBBGGLADD-PJKMHFRUSA-N |
| SMILES | C(CC(=O)O)C1=NC2=C(NC(=O)NC2=O)N(C1=O)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)