Products 2916865-81-9
CAS 2916865-81-9 is the registry number for 8-(tert-Butyl) 2-methyl (1R,5S)-4-oxo-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-O-tert-butyl 2-O-methyl (1R,5S)-4-oxo-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 2916865-81-9) is a chemical compound with the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl (1R,5S)-4-oxo-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: QSKGYHIBETVRGC-WGTSGOJVSA-N.
| Molecular formula | C13H20N2O5 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl (1R,5S)-4-oxo-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate |
| InChIKey | QSKGYHIBETVRGC-WGTSGOJVSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C(=O)NC2C(=O)OC |
Computed by PubChem (NCBI)