Products 2387600-23-7

CAS 2387600-23-7 is the registry number for 4-(tert-Butyl) 3-methyl 3-(cyanomethyl)morpholine-3,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-O-tert-butyl 3-O-methyl 3-(cyanomethyl)morpholine-3,4-dicarboxylate (CAS 2387600-23-7) is a chemical compound with the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. IUPAC name: 4-O-tert-butyl 3-O-methyl 3-(cyanomethyl)morpholine-3,4-dicarboxylate. InChIKey: CZYHEDKBKUYDCF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O5
Molecular weight284.31 g/mol
IUPAC name4-O-tert-butyl 3-O-methyl 3-(cyanomethyl)morpholine-3,4-dicarboxylate
InChIKeyCZYHEDKBKUYDCF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOCC1(CC#N)C(=O)OC

Computed by PubChem (NCBI)