Products 227599-87-3
CAS 227599-87-3 is the registry number for Oseltamivir Impurity 181. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4R,5S)-4-acetamido-3-acetyloxy-5-aminocyclohexene-1-carboxylate (CAS 227599-87-3) is a chemical compound with the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-acetamido-3-acetyloxy-5-aminocyclohexene-1-carboxylate. InChIKey: DWAMWYJBMJVAGE-QJPTWQEYSA-N.
| Molecular formula | C13H20N2O5 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-acetamido-3-acetyloxy-5-aminocyclohexene-1-carboxylate |
| InChIKey | DWAMWYJBMJVAGE-QJPTWQEYSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@@H]([C@H](C1)N)NC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)