CAS 291778-49-9 appears in our catalog under these names: Benzyl ((2S,3R)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl)carbamate, 95%, benzyl ((2S，3S)–1，1，1–trifluoro–2–hydroxy–4–methylpentan–3–yl)carbamate. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Benzyl N-[(2S,3S)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl]carbamate (CAS 291778-49-9) is a chemical compound with the molecular formula C14H18F3NO3 and a molecular weight of 305.29 g/mol. IUPAC name: benzyl N-[(2S,3S)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl]carbamate. InChIKey: SESFXBYSHTUGNX-RYUDHWBXSA-N.
| Molecular formula | C14H18F3NO3 |
|---|---|
| Molecular weight | 305.29 g/mol |
| IUPAC name | benzyl N-[(2S,3S)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl]carbamate |
| InChIKey | SESFXBYSHTUGNX-RYUDHWBXSA-N |
| SMILES | CC(C)[C@@H]([C@@H](C(F)(F)F)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)