Products 2918293-96-4

CAS 2918293-96-4 is the registry number for 2-(3-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-4-methoxyphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxyphenoxy]acetic acid (CAS 2918293-96-4) is a chemical compound with the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. IUPAC name: 2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxyphenoxy]acetic acid. InChIKey: QRBZTQJRZHLFRY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14N2O6
Molecular weight294.26 g/mol
IUPAC name2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxyphenoxy]acetic acid
InChIKeyQRBZTQJRZHLFRY-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)OCC(=O)O)N2CCC(=O)NC2=O

Computed by PubChem (NCBI)