Products 75533-14-1
CAS 75533-14-1 is the registry number for Sarubicin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,6,11-trihydroxy-4-imino-10-methyl-3-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-2(7),5-diene-5-carboxamide (CAS 75533-14-1) is a chemical compound with the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. IUPAC name: 1,6,11-trihydroxy-4-imino-10-methyl-3-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-2(7),5-diene-5-carboxamide. InChIKey: XGXZRIYLDVKOFX-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O6 |
|---|---|
| Molecular weight | 294.26 g/mol |
| IUPAC name | 1,6,11-trihydroxy-4-imino-10-methyl-3-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-2(7),5-diene-5-carboxamide |
| InChIKey | XGXZRIYLDVKOFX-UHFFFAOYSA-N |
| SMILES | CC1C2(C(CC(O1)C3=C2C(=O)C(=N)C(=C3O)C(=O)N)O)O |
Computed by PubChem (NCBI)
Synonyms:
Sarcinamycin-A, orb2814049