Products 2918773-63-2
CAS 2918773-63-2 is the registry number for iNOS inhibitor-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]benzenecarboximidamide (CAS 2918773-63-2) is a chemical compound with the molecular formula C22H23N3O2S and a molecular weight of 393.5 g/mol. IUPAC name: N'-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]benzenecarboximidamide. InChIKey: APXSFESQCMJVLQ-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O2S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | N'-[[3-[[(4-methylphenyl)sulfonylamino]methyl]phenyl]methyl]benzenecarboximidamide |
| InChIKey | APXSFESQCMJVLQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC2=CC(=CC=C2)CN=C(C3=CC=CC=C3)N |
Computed by PubChem (NCBI)
Synonyms:
iNOS inhibitor-10, orb1744773