Products 878949-21-4

CAS 878949-21-4 is the registry number for DCEM1, 99.31%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

N-(1H-benzimidazol-2-ylmethyl)-1-[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methanamine (CAS 878949-21-4) is a chemical compound with the molecular formula C22H23N3O2S and a molecular weight of 393.5 g/mol. IUPAC name: N-(1H-benzimidazol-2-ylmethyl)-1-[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methanamine. InChIKey: WPKVLNVHJJPTEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H23N3O2S
Molecular weight393.5 g/mol
IUPAC nameN-(1H-benzimidazol-2-ylmethyl)-1-[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methanamine
InChIKeyWPKVLNVHJJPTEZ-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)CNCC2=NC3=CC=CC=C3N2)OCC4=CC=CS4

Computed by PubChem (NCBI)

Synonyms: orb3027732