Products 2918779-88-9

CAS 2918779-88-9 is the registry number for ethyl 1-oxa-4-azaspiro[5.5]undecane-9-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1-oxa-4-azaspiro[5.5]undecane-9-carboxylate;hydrochloride (CAS 2918779-88-9) is a chemical compound with the molecular formula C12H22ClNO3 and a molecular weight of 263.76 g/mol. IUPAC name: ethyl 1-oxa-4-azaspiro[5.5]undecane-9-carboxylate;hydrochloride. InChIKey: VXUBBBFPOQKXMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22ClNO3
Molecular weight263.76 g/mol
IUPAC nameethyl 1-oxa-4-azaspiro[5.5]undecane-9-carboxylate;hydrochloride
InChIKeyVXUBBBFPOQKXMQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCC2(CC1)CNCCO2.Cl

Computed by PubChem (NCBI)