CAS 294646-46-1 appears in our catalog under these names: tert-Butyl (2S,3S)-2-(2-chloroacetamido)-3-methylpentanoate, 95%, tert-Butyl (2S,3S)-2-(2-chloroacetamido)-3-methylpentanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Tert-butyl (2S,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoate (CAS 294646-46-1) is a chemical compound with the molecular formula C12H22ClNO3 and a molecular weight of 263.76 g/mol. IUPAC name: tert-butyl (2S,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoate. InChIKey: QOZKGUFVLXWMCU-WPRPVWTQSA-N.
| Molecular formula | C12H22ClNO3 |
|---|---|
| Molecular weight | 263.76 g/mol |
| IUPAC name | tert-butyl (2S,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoate |
| InChIKey | QOZKGUFVLXWMCU-WPRPVWTQSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)NC(=O)CCl |
Computed by PubChem (NCBI)