CAS 2918780-07-9 is the registry number for 2,6-Dibromo-3-(methylsulfonyl)pyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2,6-dibromo-3-methylsulfonylpyridine (CAS 2918780-07-9) is a chemical compound with the molecular formula C6H5Br2NO2S and a molecular weight of 314.98 g/mol. IUPAC name: 2,6-dibromo-3-methylsulfonylpyridine. InChIKey: KDBXIIKEWVULGG-UHFFFAOYSA-N.
| Molecular formula | C6H5Br2NO2S |
|---|---|
| Molecular weight | 314.98 g/mol |
| IUPAC name | 2,6-dibromo-3-methylsulfonylpyridine |
| InChIKey | KDBXIIKEWVULGG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(N=C(C=C1)Br)Br |
Computed by PubChem (NCBI)