CAS 7467-11-0 appears in our catalog under these names: 2,5-Dibromobenzenesulfonamide, 97%, 2,5-Dibromobenzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 2,5g, 0,25g.
2,5-dibromobenzenesulfonamide (CAS 7467-11-0) is a chemical compound with the molecular formula C6H5Br2NO2S and a molecular weight of 314.98 g/mol. IUPAC name: 2,5-dibromobenzenesulfonamide. InChIKey: INERZUPHFUUUPD-UHFFFAOYSA-N.
| Molecular formula | C6H5Br2NO2S |
|---|---|
| Molecular weight | 314.98 g/mol |
| IUPAC name | 2,5-dibromobenzenesulfonamide |
| InChIKey | INERZUPHFUUUPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)N)Br |
Computed by PubChem (NCBI)