CAS 2918817-61-3 is the registry number for Methyl (R)-2-hydroxy-5,5-dimethylhexanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-2-hydroxy-5,5-dimethylhexanoate (CAS 2918817-61-3) is a chemical compound with the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. IUPAC name: methyl (2R)-2-hydroxy-5,5-dimethylhexanoate. InChIKey: PLSMJQZHVGPMOP-SSDOTTSWSA-N.
| Molecular formula | C9H18O3 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | methyl (2R)-2-hydroxy-5,5-dimethylhexanoate |
| InChIKey | PLSMJQZHVGPMOP-SSDOTTSWSA-N |
| SMILES | CC(C)(C)CC[C@H](C(=O)OC)O |
Computed by PubChem (NCBI)