CAS 2918876-36-3 is the registry number for 1-bromo-3,4-dimethyl-2-((3-methylbenzyl)oxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3,4-dimethyl-2-[(3-methylphenyl)methoxy]benzene (CAS 2918876-36-3) is a chemical compound with the molecular formula C16H17BrO and a molecular weight of 305.21 g/mol. IUPAC name: 1-bromo-3,4-dimethyl-2-[(3-methylphenyl)methoxy]benzene. InChIKey: SLTYQAJVHNVOQI-UHFFFAOYSA-N.
| Molecular formula | C16H17BrO |
|---|---|
| Molecular weight | 305.21 g/mol |
| IUPAC name | 1-bromo-3,4-dimethyl-2-[(3-methylphenyl)methoxy]benzene |
| InChIKey | SLTYQAJVHNVOQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)COC2=C(C=CC(=C2C)C)Br |
Computed by PubChem (NCBI)