Products 2918953-29-2
CAS 2918953-29-2 is the registry number for Methyl 3-(3-bromophenyl)-3-hydroxybutanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-(3-bromophenyl)-3-hydroxybutanoate (CAS 2918953-29-2) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: methyl 3-(3-bromophenyl)-3-hydroxybutanoate. InChIKey: FZJFYXRQAXTBNJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | methyl 3-(3-bromophenyl)-3-hydroxybutanoate |
| InChIKey | FZJFYXRQAXTBNJ-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)OC)(C1=CC(=CC=C1)Br)O |
Computed by PubChem (NCBI)