Products 2918964-31-3
CAS 2918964-31-3 is the registry number for (6-bromo-2-fluoro-3-methylphenyl)(phenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(6-bromo-2-fluoro-3-methylphenyl)-phenylmethanone (CAS 2918964-31-3) is a chemical compound with the molecular formula C14H10BrFO and a molecular weight of 293.13 g/mol. IUPAC name: (6-bromo-2-fluoro-3-methylphenyl)-phenylmethanone. InChIKey: RXVPZGSOIQAREA-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO |
|---|---|
| Molecular weight | 293.13 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-methylphenyl)-phenylmethanone |
| InChIKey | RXVPZGSOIQAREA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C(=O)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)