CAS 64169-66-0 is the registry number for 1-(4-Fluorophenyl)-5-bromophthalan. Offered by: TRC. Available pack sizes: 2,5g.
5-bromo-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran (CAS 64169-66-0) is a chemical compound with the molecular formula C14H10BrFO and a molecular weight of 293.13 g/mol. IUPAC name: 5-bromo-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran. InChIKey: JMRFFXXIKAWNQQ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrFO |
|---|---|
| Molecular weight | 293.13 g/mol |
| IUPAC name | 5-bromo-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran |
| InChIKey | JMRFFXXIKAWNQQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(O1)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)