Products 2920040-00-0

CAS 2920040-00-0 is the registry number for 3,5-Dimethyl-4-(2-oxido-1-cyano)-phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-hydroxy-2,6-dimethylbenzonitrile oxide (CAS 2920040-00-0) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 4-hydroxy-2,6-dimethylbenzonitrile oxide. InChIKey: HNNAPEKNZNNVAB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO2
Molecular weight163.17 g/mol
IUPAC name4-hydroxy-2,6-dimethylbenzonitrile oxide
InChIKeyHNNAPEKNZNNVAB-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C#[N+][O-])C)O

Computed by PubChem (NCBI)