CAS 2920040-00-0 is the registry number for 3,5-Dimethyl-4-(2-oxido-1-cyano)-phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-hydroxy-2,6-dimethylbenzonitrile oxide (CAS 2920040-00-0) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 4-hydroxy-2,6-dimethylbenzonitrile oxide. InChIKey: HNNAPEKNZNNVAB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | 4-hydroxy-2,6-dimethylbenzonitrile oxide |
| InChIKey | HNNAPEKNZNNVAB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C#[N+][O-])C)O |
Computed by PubChem (NCBI)