Products 2920219-56-1
CAS 2920219-56-1 is the registry number for (S)-(1,4-Oxazepan-2-yl)methanol oxalate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Oxalic acid;[(2S)-1,4-oxazepan-2-yl]methanol (CAS 2920219-56-1) is a chemical compound with the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. IUPAC name: oxalic acid;[(2S)-1,4-oxazepan-2-yl]methanol. InChIKey: DOLXMVIFIDAIJN-RGMNGODLSA-N.
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | oxalic acid;[(2S)-1,4-oxazepan-2-yl]methanol |
| InChIKey | DOLXMVIFIDAIJN-RGMNGODLSA-N |
| SMILES | C1CNC[C@H](OC1)CO.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)