CAS 2921042-73-9 is the registry number for Methyl (S)-2-amino-6,6,6-trifluoro-5,5-dimethylhexanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-6,6,6-trifluoro-5,5-dimethylhexanoate (CAS 2921042-73-9) is a chemical compound with the molecular formula C9H16F3NO2 and a molecular weight of 227.22 g/mol. IUPAC name: methyl (2S)-2-amino-6,6,6-trifluoro-5,5-dimethylhexanoate. InChIKey: FCPPEIRGXLQIRX-LURJTMIESA-N.
| Molecular formula | C9H16F3NO2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | methyl (2S)-2-amino-6,6,6-trifluoro-5,5-dimethylhexanoate |
| InChIKey | FCPPEIRGXLQIRX-LURJTMIESA-N |
| SMILES | CC(C)(CC[C@@H](C(=O)OC)N)C(F)(F)F |
Computed by PubChem (NCBI)