CAS 2940950-81-0 is the registry number for 3-isobutylazetidine,2,2,2-trifluoroacetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-methylpropyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2940950-81-0) is a chemical compound with the molecular formula C9H16F3NO2 and a molecular weight of 227.22 g/mol. IUPAC name: 3-(2-methylpropyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: XWQYUCRIBFOXSP-UHFFFAOYSA-N.
| Molecular formula | C9H16F3NO2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 3-(2-methylpropyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | XWQYUCRIBFOXSP-UHFFFAOYSA-N |
| SMILES | CC(C)CC1CNC1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)