Products 478022-18-3

CAS 478022-18-3 is the registry number for 5-(tert-Butyl)-3-((4-chlorophenyl)sulfonamido)thiophene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-tert-butylthiophene-2-carboxylic acid (CAS 478022-18-3) is a chemical compound with the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. IUPAC name: 5-tert-butylthiophene-2-carboxylic acid. InChIKey: BJDXNKJQTLSJPM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O2S
Molecular weight184.26 g/mol
IUPAC name5-tert-butylthiophene-2-carboxylic acid
InChIKeyBJDXNKJQTLSJPM-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(S1)C(=O)O

Computed by PubChem (NCBI)