Products 2921709-93-3
CAS 2921709-93-3 is the registry number for 6-chloro-7-methoxy-2-methyl-2H-indazole, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6-chloro-7-methoxy-2-methylindazole (CAS 2921709-93-3) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 6-chloro-7-methoxy-2-methylindazole. InChIKey: OXWUWGHLUHXFNO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 6-chloro-7-methoxy-2-methylindazole |
| InChIKey | OXWUWGHLUHXFNO-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=CC(=C(C2=N1)OC)Cl |
Computed by PubChem (NCBI)