Products 2921898-05-5
CAS 2921898-05-5 is the registry number for 2-(benzyloxy)-1-bromo-5-chloro-3-methylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-5-chloro-3-methyl-2-phenylmethoxybenzene (CAS 2921898-05-5) is a chemical compound with the molecular formula C14H12BrClO and a molecular weight of 311.60 g/mol. IUPAC name: 1-bromo-5-chloro-3-methyl-2-phenylmethoxybenzene. InChIKey: KIUIWGLKWWFHMH-UHFFFAOYSA-N.
| Molecular formula | C14H12BrClO |
|---|---|
| Molecular weight | 311.60 g/mol |
| IUPAC name | 1-bromo-5-chloro-3-methyl-2-phenylmethoxybenzene |
| InChIKey | KIUIWGLKWWFHMH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC2=CC=CC=C2)Br)Cl |
Computed by PubChem (NCBI)