Products 2921922-19-0
CAS 2921922-19-0 is the registry number for (3-(7H-Pyrrolo[2,3-d]pyrimidin-4-yl)phenyl)methanamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methanamine (CAS 2921922-19-0) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: [3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methanamine. InChIKey: BOHQAKURPXGSME-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | [3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methanamine |
| InChIKey | BOHQAKURPXGSME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=C3C=CNC3=NC=N2)CN |
Computed by PubChem (NCBI)