CAS 2922814-80-8 is the registry number for NLRP3-IN-28. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-methylsulfonylpyridazin-3-yl)-5-(trifluoromethyl)phenol (CAS 2922814-80-8) is a chemical compound with the molecular formula C12H9F3N2O3S and a molecular weight of 318.27 g/mol. IUPAC name: 2-(6-methylsulfonylpyridazin-3-yl)-5-(trifluoromethyl)phenol. InChIKey: BZEQKTJEEFQRQK-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O3S |
|---|---|
| Molecular weight | 318.27 g/mol |
| IUPAC name | 2-(6-methylsulfonylpyridazin-3-yl)-5-(trifluoromethyl)phenol |
| InChIKey | BZEQKTJEEFQRQK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=C(C=C1)C2=C(C=C(C=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)