CAS 725699-00-3 is the registry number for 5-(([4-Methyl-6-(trifluoromethyl)pyrimidin-2-yl]thio)methyl)-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]furan-2-carboxylic acid (CAS 725699-00-3) is a chemical compound with the molecular formula C12H9F3N2O3S and a molecular weight of 318.27 g/mol. IUPAC name: 5-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]furan-2-carboxylic acid. InChIKey: NQTKTDJZTAKSLU-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O3S |
|---|---|
| Molecular weight | 318.27 g/mol |
| IUPAC name | 5-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylmethyl]furan-2-carboxylic acid |
| InChIKey | NQTKTDJZTAKSLU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC2=CC=C(O2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)